About 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide
5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide (PubChem CID 136515181) has the molecular formula C17H19N5O
and a molecular weight of 309.37 g/mol. Its IUPAC name is 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide |
| PubChem CID | 136515181 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cccc2nc(CNC(=O)c3cc(C4CC4)[nH]n3)n(C)c12 |
| InChI | InChI=1S/C17H19N5O/c1-10-4-3-5-12-16(10)22(2)15(19-12)9-18-17(23)14-8-13(20-21-14)11-6-7-11/h3-5,8,11H,6-7,9H2,1-2H3,(H,18,23)(H,20,21) |
| InChIKey | HUYBYESJAWEWEW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide?
The IUPAC name of 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide (CID 136515181) is 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide.
What is the SMILES notation for 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide?
The canonical SMILES for 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide is Cc1cccc2nc(CNC(=O)c3cc(C4CC4)[nH]n3)n(C)c12.
What is the InChIKey of 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide?
The InChIKey is HUYBYESJAWEWEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O/c1-10-4-3-5-12-16(10)22(2)15(19-12)9-18-17(23)14-8-13(20-21-14)11-6-7-11/h3-5,8,11H,6-7,9H2,1-2H3,(H,18,23)(H,20,21).
What are the key properties of 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide?
5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide has a molecular weight of 309.37 g/mol, XLogP of 2.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-N-[(1,7-dimethylbenzimidazol-2-yl)methyl]-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 136515181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).