C14H16F3N5O — CID 136516050
1-cyano-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]cyclobutane-1-carboxamide (PubChem CID 136516050) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is 1-cyano-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]cyclobutane-1-carboxamide.
| Compound Name | 1-cyano-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 136516050 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-cyano-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]cyclobutane-1-carboxamide |
| SMILES | N#CC1(C(=O)NCc2nnc3n2CC(C(F)(F)F)CC3)CCC1 |
| InChI | InChI=1S/C14H16F3N5O/c15-14(16,17)9-2-3-10-20-21-11(22(10)7-9)6-19-12(23)13(8-18)4-1-5-13/h9H,1-7H2,(H,19,23) |
| InChIKey | IKQQRLYEOFROTO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |