About 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide
2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide (PubChem CID 136516392) has the molecular formula C11H22N2O3S
and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide.
Molecular Properties
| Compound Name | 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide |
| PubChem CID | 136516392 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide |
| SMILES | CC1CC1NC(=O)C(NS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O3S/c1-7-6-8(7)12-10(14)9(11(2,3)4)13-17(5,15)16/h7-9,13H,6H2,1-5H3,(H,12,14) |
| InChIKey | RGTYEXPRCKIEIP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide?
The IUPAC name of 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide (CID 136516392) is 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide.
What is the SMILES notation for 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide?
The canonical SMILES for 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide is CC1CC1NC(=O)C(NS(C)(=O)=O)C(C)(C)C.
What is the InChIKey of 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide?
The InChIKey is RGTYEXPRCKIEIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3S/c1-7-6-8(7)12-10(14)9(11(2,3)4)13-17(5,15)16/h7-9,13H,6H2,1-5H3,(H,12,14).
What are the key properties of 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide?
2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide has a molecular weight of 262.38 g/mol, XLogP of 0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methanesulfonamido)-3,3-dimethyl-N-(2-methylcyclopropyl)butanamide is sourced from PubChem (CID 136516392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).