About 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide
1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide (PubChem CID 136516663) has the molecular formula C11H15F3N4O3S
and a molecular weight of 340.33 g/mol. Its IUPAC name is 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide |
| PubChem CID | 136516663 |
| Molecular Formula | C11H15F3N4O3S |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC2CCCN(CC(F)(F)F)C2=O)cn1 |
| InChI | InChI=1S/C11H15F3N4O3S/c1-17-6-8(5-15-17)22(20,21)16-9-3-2-4-18(10(9)19)7-11(12,13)14/h5-6,9,16H,2-4,7H2,1H3 |
| InChIKey | FWPNPCMWTPYAKE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide?
The IUPAC name of 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide (CID 136516663) is 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide.
What is the SMILES notation for 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide?
The canonical SMILES for 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide is Cn1cc(S(=O)(=O)NC2CCCN(CC(F)(F)F)C2=O)cn1.
What is the InChIKey of 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide?
The InChIKey is FWPNPCMWTPYAKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N4O3S/c1-17-6-8(5-15-17)22(20,21)16-9-3-2-4-18(10(9)19)7-11(12,13)14/h5-6,9,16H,2-4,7H2,1H3.
What are the key properties of 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide?
1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide has a molecular weight of 340.33 g/mol, XLogP of 0.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[2-oxo-1-(2,2,2-trifluoroethyl)piperidin-3-yl]pyrazole-4-sulfonamide is sourced from PubChem (CID 136516663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).