C15H13N5O3 — CID 136517156
(6-nitro-1H-indol-3-yl)-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)methanone (PubChem CID 136517156) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is (6-nitro-1H-indol-3-yl)-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)methanone.
| Compound Name | (6-nitro-1H-indol-3-yl)-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 136517156 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (6-nitro-1H-indol-3-yl)-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)methanone |
| SMILES | O=C(c1c[nH]c2cc([N+](=O)[O-])ccc12)N1CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C15H13N5O3/c21-15(19-4-3-9-6-17-18-14(9)8-19)12-7-16-13-5-10(20(22)23)1-2-11(12)13/h1-2,5-7,16H,3-4,8H2,(H,17,18) |
| InChIKey | JWYHAISBXVQFPJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|