About 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide
3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide (PubChem CID 136517186) has the molecular formula C11H18BrNO3S2
and a molecular weight of 356.31 g/mol. Its IUPAC name is 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide |
| PubChem CID | 136517186 |
| Molecular Formula | C11H18BrNO3S2 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide |
| SMILES | CN(C(CO)C(C)(C)C)S(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C11H18BrNO3S2/c1-11(2,3)9(7-14)13(4)18(15,16)10-8(12)5-6-17-10/h5-6,9,14H,7H2,1-4H3 |
| InChIKey | PVEGDSBYVJNZMP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide?
The IUPAC name of 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide (CID 136517186) is 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide.
What is the SMILES notation for 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide?
The canonical SMILES for 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide is CN(C(CO)C(C)(C)C)S(=O)(=O)c1sccc1Br.
What is the InChIKey of 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide?
The InChIKey is PVEGDSBYVJNZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18BrNO3S2/c1-11(2,3)9(7-14)13(4)18(15,16)10-8(12)5-6-17-10/h5-6,9,14H,7H2,1-4H3.
What are the key properties of 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide?
3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide has a molecular weight of 356.31 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(1-hydroxy-3,3-dimethylbutan-2-yl)-N-methylthiophene-2-sulfonamide is sourced from PubChem (CID 136517186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).