C15H19FN4O2S — CID 136517514
5-(4-fluoro-3-methylphenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]tetrazole (PubChem CID 136517514) has the molecular formula C15H19FN4O2S and a molecular weight of 338.41 g/mol. Its IUPAC name is 5-(4-fluoro-3-methylphenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]tetrazole.
| Compound Name | 5-(4-fluoro-3-methylphenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]tetrazole |
|---|---|
| PubChem CID | 136517514 |
| Molecular Formula | C15H19FN4O2S |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 5-(4-fluoro-3-methylphenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]tetrazole |
| SMILES | Cc1cc(-c2nnn(CC3(CS(C)(=O)=O)CCC3)n2)ccc1F |
| InChI | InChI=1S/C15H19FN4O2S/c1-11-8-12(4-5-13(11)16)14-17-19-20(18-14)9-15(6-3-7-15)10-23(2,21)22/h4-5,8H,3,6-7,9-10H2,1-2H3 |
| InChIKey | GWFBMUCRJIHQOZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |