C20H28N4O3 — CID 136518363
3-[(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-N-(2-methylpropyl)benzamide (PubChem CID 136518363) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-[(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 3-[(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 136518363 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 3-[(3-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CNC(=O)c1cccc(CN2CCC3(CC2)NC(=O)N(C)C3=O)c1 |
| InChI | InChI=1S/C20H28N4O3/c1-14(2)12-21-17(25)16-6-4-5-15(11-16)13-24-9-7-20(8-10-24)18(26)23(3)19(27)22-20/h4-6,11,14H,7-10,12-13H2,1-3H3,(H,21,25)(H,22,27) |
| InChIKey | PCDGIXLUITWQED-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|