About 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole
5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole (PubChem CID 136520091) has the molecular formula C13H12BrFN2O2S2
and a molecular weight of 391.29 g/mol. Its IUPAC name is 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole |
| PubChem CID | 136520091 |
| Molecular Formula | C13H12BrFN2O2S2 |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1nc(S(=O)(=O)N2CCc3c(F)cccc3C2)sc1Br |
| InChI | InChI=1S/C13H12BrFN2O2S2/c1-8-12(14)20-13(16-8)21(18,19)17-6-5-10-9(7-17)3-2-4-11(10)15/h2-4H,5-7H2,1H3 |
| InChIKey | CKLIYPVUDRPKCU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole?
The IUPAC name of 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole (CID 136520091) is 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole.
What is the SMILES notation for 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole?
The canonical SMILES for 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole is Cc1nc(S(=O)(=O)N2CCc3c(F)cccc3C2)sc1Br.
What is the InChIKey of 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole?
The InChIKey is CKLIYPVUDRPKCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrFN2O2S2/c1-8-12(14)20-13(16-8)21(18,19)17-6-5-10-9(7-17)3-2-4-11(10)15/h2-4H,5-7H2,1H3.
What are the key properties of 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole?
5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole has a molecular weight of 391.29 g/mol, XLogP of 3.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-[(5-fluoro-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]-4-methyl-1,3-thiazole is sourced from PubChem (CID 136520091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).