C18H26F3N3O3 — CID 136520536
2-[2-[2,2-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 136520536) has the molecular formula C18H26F3N3O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-[2-[2,2-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-[2-[2,2-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 136520536 |
| Molecular Formula | C18H26F3N3O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[2-[2,2-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-oxoethyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1(C)CN(CC(F)(F)F)CCN1C(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C18H26F3N3O3/c1-17(2)10-22(11-18(19,20)21)7-8-24(17)14(25)9-23-15(26)12-5-3-4-6-13(12)16(23)27/h12-13H,3-11H2,1-2H3 |
| InChIKey | DLSDPVAGTYMICB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|