C16H18F3N3O2 — CID 136521345
3-(furan-2-yl)-1-[4-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]propan-1-one (PubChem CID 136521345) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-[4-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-(furan-2-yl)-1-[4-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 136521345 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-(furan-2-yl)-1-[4-[3-(trifluoromethyl)pyrazol-1-yl]piperidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccco1)N1CCC(n2ccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C16H18F3N3O2/c17-16(18,19)14-7-10-22(20-14)12-5-8-21(9-6-12)15(23)4-3-13-2-1-11-24-13/h1-2,7,10-12H,3-6,8-9H2 |
| InChIKey | LGYQECZLOQTTBB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |