C12H16N6O3 — CID 136521506
2-[2-(1,3-dimethyl-5,6-dihydropyrazolo[5,4-b][1,4]oxazin-4-yl)-2-oxoethyl]-4-methyl-1,2,4-triazol-3-one (PubChem CID 136521506) has the molecular formula C12H16N6O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-[2-(1,3-dimethyl-5,6-dihydropyrazolo[5,4-b][1,4]oxazin-4-yl)-2-oxoethyl]-4-methyl-1,2,4-triazol-3-one.
| Compound Name | 2-[2-(1,3-dimethyl-5,6-dihydropyrazolo[5,4-b][1,4]oxazin-4-yl)-2-oxoethyl]-4-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 136521506 |
| Molecular Formula | C12H16N6O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[2-(1,3-dimethyl-5,6-dihydropyrazolo[5,4-b][1,4]oxazin-4-yl)-2-oxoethyl]-4-methyl-1,2,4-triazol-3-one |
| SMILES | Cc1nn(C)c2c1N(C(=O)Cn1ncn(C)c1=O)CCO2 |
| InChI | InChI=1S/C12H16N6O3/c1-8-10-11(16(3)14-8)21-5-4-17(10)9(19)6-18-12(20)15(2)7-13-18/h7H,4-6H2,1-3H3 |
| InChIKey | VHQRTBSKFYXDAU-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 87.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |