C13H16F3N3O2S — CID 136521667
3-oxo-3-[4-(1,3-thiazol-2-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 136521667) has the molecular formula C13H16F3N3O2S and a molecular weight of 335.35 g/mol. Its IUPAC name is 3-oxo-3-[4-(1,3-thiazol-2-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 3-oxo-3-[4-(1,3-thiazol-2-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 136521667 |
| Molecular Formula | C13H16F3N3O2S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 3-oxo-3-[4-(1,3-thiazol-2-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | O=C(CC(=O)N1CCC(c2nccs2)CC1)NCC(F)(F)F |
| InChI | InChI=1S/C13H16F3N3O2S/c14-13(15,16)8-18-10(20)7-11(21)19-4-1-9(2-5-19)12-17-3-6-22-12/h3,6,9H,1-2,4-5,7-8H2,(H,18,20) |
| InChIKey | GVRNGMTUEFDGRL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|