C18H26N4O3 — CID 136522058
4-(furan-2-carbonyl)-N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]piperazine-1-carboxamide (PubChem CID 136522058) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(furan-2-carbonyl)-N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 136522058 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 4-(furan-2-carbonyl)-N-[1-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)ethyl]piperazine-1-carboxamide |
| SMILES | CC(NC(=O)N1CCN(C(=O)c2ccco2)CC1)C1=CCN(C)CC1 |
| InChI | InChI=1S/C18H26N4O3/c1-14(15-5-7-20(2)8-6-15)19-18(24)22-11-9-21(10-12-22)17(23)16-4-3-13-25-16/h3-5,13-14H,6-12H2,1-2H3,(H,19,24) |
| InChIKey | QDJTZZIAZYPWCU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|