About N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide
N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide (PubChem CID 136525314) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide |
| PubChem CID | 136525314 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide |
| SMILES | CN(C(=O)c1cccn(C)c1=O)C1CCCC1 |
| InChI | InChI=1S/C13H18N2O2/c1-14-9-5-8-11(12(14)16)13(17)15(2)10-6-3-4-7-10/h5,8-10H,3-4,6-7H2,1-2H3 |
| InChIKey | NWPWXANFPJQZME-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide?
The IUPAC name of N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide (CID 136525314) is N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide.
What is the SMILES notation for N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide?
The canonical SMILES for N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide is CN(C(=O)c1cccn(C)c1=O)C1CCCC1.
What is the InChIKey of N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide?
The InChIKey is NWPWXANFPJQZME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-14-9-5-8-11(12(14)16)13(17)15(2)10-6-3-4-7-10/h5,8-10H,3-4,6-7H2,1-2H3.
What are the key properties of N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide?
N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide has a molecular weight of 234.30 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-N,1-dimethyl-2-oxopyridine-3-carboxamide is sourced from PubChem (CID 136525314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).