C18H28N2O2 — CID 136525412
N-(1-benzylpiperidin-4-yl)-3-methoxy-N,2-dimethylpropanamide (PubChem CID 136525412) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-methoxy-N,2-dimethylpropanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-methoxy-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 136525412 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-methoxy-N,2-dimethylpropanamide |
| SMILES | COCC(C)C(=O)N(C)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H28N2O2/c1-15(14-22-3)18(21)19(2)17-9-11-20(12-10-17)13-16-7-5-4-6-8-16/h4-8,15,17H,9-14H2,1-3H3 |
| InChIKey | PTYLZRXHRIOXMS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |