About N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide
N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide (PubChem CID 136525661) has the molecular formula C12H16F3N3O3S
and a molecular weight of 339.34 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide |
| PubChem CID | 136525661 |
| Molecular Formula | C12H16F3N3O3S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1NCC(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C12H16F3N3O3S/c13-12(14,15)9-16-10-3-1-2-4-11(10)17-22(19,20)18-5-7-21-8-6-18/h1-4,16-17H,5-9H2 |
| InChIKey | PNWOZDFXNAOGSH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide?
The IUPAC name of N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide (CID 136525661) is N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide.
What is the SMILES notation for N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide?
The canonical SMILES for N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide is O=S(=O)(Nc1ccccc1NCC(F)(F)F)N1CCOCC1.
What is the InChIKey of N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide?
The InChIKey is PNWOZDFXNAOGSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3O3S/c13-12(14,15)9-16-10-3-1-2-4-11(10)17-22(19,20)18-5-7-21-8-6-18/h1-4,16-17H,5-9H2.
What are the key properties of N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide?
N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide has a molecular weight of 339.34 g/mol, XLogP of 1.65, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,2,2-trifluoroethylamino)phenyl]morpholine-4-sulfonamide is sourced from PubChem (CID 136525661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).