C23H30N4O2 — CID 136526026
5-(4-benzylpiperidine-1-carbonyl)-1-methyl-6-(1-methylpyrazol-4-yl)piperidin-2-one (PubChem CID 136526026) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 5-(4-benzylpiperidine-1-carbonyl)-1-methyl-6-(1-methylpyrazol-4-yl)piperidin-2-one.
| Compound Name | 5-(4-benzylpiperidine-1-carbonyl)-1-methyl-6-(1-methylpyrazol-4-yl)piperidin-2-one |
|---|---|
| PubChem CID | 136526026 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 5-(4-benzylpiperidine-1-carbonyl)-1-methyl-6-(1-methylpyrazol-4-yl)piperidin-2-one |
| SMILES | CN1C(=O)CCC(C(=O)N2CCC(Cc3ccccc3)CC2)C1c1cnn(C)c1 |
| InChI | InChI=1S/C23H30N4O2/c1-25-16-19(15-24-25)22-20(8-9-21(28)26(22)2)23(29)27-12-10-18(11-13-27)14-17-6-4-3-5-7-17/h3-7,15-16,18,20,22H,8-14H2,1-2H3 |
| InChIKey | RTYFSRMFCAAGJO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |