C22H23N3O4 — CID 136527236
9-oxo-N-[2-(pyridin-3-ylmethylcarbamoyl)phenyl]-3-oxabicyclo[3.3.1]nonane-7-carboxamide (PubChem CID 136527236) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 9-oxo-N-[2-(pyridin-3-ylmethylcarbamoyl)phenyl]-3-oxabicyclo[3.3.1]nonane-7-carboxamide.
| Compound Name | 9-oxo-N-[2-(pyridin-3-ylmethylcarbamoyl)phenyl]-3-oxabicyclo[3.3.1]nonane-7-carboxamide |
|---|---|
| PubChem CID | 136527236 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 9-oxo-N-[2-(pyridin-3-ylmethylcarbamoyl)phenyl]-3-oxabicyclo[3.3.1]nonane-7-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1ccccc1NC(=O)C1CC2COCC(C1)C2=O |
| InChI | InChI=1S/C22H23N3O4/c26-20-16-8-15(9-17(20)13-29-12-16)21(27)25-19-6-2-1-5-18(19)22(28)24-11-14-4-3-7-23-10-14/h1-7,10,15-17H,8-9,11-13H2,(H,24,28)(H,25,27) |
| InChIKey | TXTQGRKRMWLTBH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |