C18H24N4O3 — CID 136527849
1-[(4-methoxyphenyl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea (PubChem CID 136527849) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 136527849 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-1-methyl-3-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]urea |
| SMILES | COc1ccc(CN(C)C(=O)Nc2cnn(CC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C18H24N4O3/c1-21(11-14-5-7-16(24-2)8-6-14)18(23)20-15-10-19-22(12-15)13-17-4-3-9-25-17/h5-8,10,12,17H,3-4,9,11,13H2,1-2H3,(H,20,23) |
| InChIKey | RRJJDGBOFGJUGH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |