C19H20N6O4 — CID 136528593
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]propanamide (PubChem CID 136528593) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 136528593 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)-N-[3-(1-methyltetrazol-5-yl)phenyl]propanamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)CCN2C(=O)C3C4CCC(O4)C3C2=O)c1 |
| InChI | InChI=1S/C19H20N6O4/c1-24-17(21-22-23-24)10-3-2-4-11(9-10)20-14(26)7-8-25-18(27)15-12-5-6-13(29-12)16(15)19(25)28/h2-4,9,12-13,15-16H,5-8H2,1H3,(H,20,26) |
| InChIKey | UQQALQANWYYUNM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|