About 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one
1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one (PubChem CID 136529848) has the molecular formula C10H9FIN3O2
and a molecular weight of 349.10 g/mol. Its IUPAC name is 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one.
Molecular Properties
| Compound Name | 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one |
| PubChem CID | 136529848 |
| Molecular Formula | C10H9FIN3O2 |
| Molecular Weight | 349.10 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one |
| SMILES | CCc1nc(Cn2cc(F)cc(I)c2=O)no1 |
| InChI | InChI=1S/C10H9FIN3O2/c1-2-9-13-8(14-17-9)5-15-4-6(11)3-7(12)10(15)16/h3-4H,2,5H2,1H3 |
| InChIKey | TUABKDLQRBWEPJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.10 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one?
The IUPAC name of 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one (CID 136529848) is 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one.
What is the SMILES notation for 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one?
The canonical SMILES for 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one is CCc1nc(Cn2cc(F)cc(I)c2=O)no1.
What is the InChIKey of 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one?
The InChIKey is TUABKDLQRBWEPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FIN3O2/c1-2-9-13-8(14-17-9)5-15-4-6(11)3-7(12)10(15)16/h3-4H,2,5H2,1H3.
What are the key properties of 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one?
1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one has a molecular weight of 349.10 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-5-fluoro-3-iodopyridin-2-one is sourced from PubChem (CID 136529848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).