C11H19N3OS — CID 136530387
2-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]pent-4-en-1-ol (PubChem CID 136530387) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]pent-4-en-1-ol.
| Compound Name | 2-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]pent-4-en-1-ol |
|---|---|
| PubChem CID | 136530387 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2-[(5-tert-butyl-1,3,4-thiadiazol-2-yl)amino]pent-4-en-1-ol |
| SMILES | C=CCC(CO)Nc1nnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C11H19N3OS/c1-5-6-8(7-15)12-10-14-13-9(16-10)11(2,3)4/h5,8,15H,1,6-7H2,2-4H3,(H,12,14) |
| InChIKey | ACCMCDUNSUSIQE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|