About N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide
N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide (PubChem CID 136531532) has the molecular formula C10H16F2N2O2
and a molecular weight of 234.25 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide |
| PubChem CID | 136531532 |
| Molecular Formula | C10H16F2N2O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide |
| SMILES | CC(C)N(CC(N)=O)C(=O)C1C(C)C1(F)F |
| InChI | InChI=1S/C10H16F2N2O2/c1-5(2)14(4-7(13)15)9(16)8-6(3)10(8,11)12/h5-6,8H,4H2,1-3H3,(H2,13,15) |
| InChIKey | XYMCFOHDZLJHJI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide?
The IUPAC name of N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide (CID 136531532) is N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide.
What is the SMILES notation for N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide?
The canonical SMILES for N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide is CC(C)N(CC(N)=O)C(=O)C1C(C)C1(F)F.
What is the InChIKey of N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide?
The InChIKey is XYMCFOHDZLJHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N2O2/c1-5(2)14(4-7(13)15)9(16)8-6(3)10(8,11)12/h5-6,8H,4H2,1-3H3,(H2,13,15).
What are the key properties of N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide?
N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide has a molecular weight of 234.25 g/mol, XLogP of 0.61, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-oxoethyl)-2,2-difluoro-3-methyl-N-propan-2-ylcyclopropane-1-carboxamide is sourced from PubChem (CID 136531532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).