About 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide
5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide (PubChem CID 136531965) has the molecular formula C11H17F2NO3S2
and a molecular weight of 313.39 g/mol. Its IUPAC name is 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide |
| PubChem CID | 136531965 |
| Molecular Formula | C11H17F2NO3S2 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NCC(F)(F)CO)s1 |
| InChI | InChI=1S/C11H17F2NO3S2/c1-10(2,3)8-4-5-9(18-8)19(16,17)14-6-11(12,13)7-15/h4-5,14-15H,6-7H2,1-3H3 |
| InChIKey | GLNXLBUJOBUWSR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide?
The IUPAC name of 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide (CID 136531965) is 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide?
The canonical SMILES for 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide is CC(C)(C)c1ccc(S(=O)(=O)NCC(F)(F)CO)s1.
What is the InChIKey of 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide?
The InChIKey is GLNXLBUJOBUWSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2NO3S2/c1-10(2,3)8-4-5-9(18-8)19(16,17)14-6-11(12,13)7-15/h4-5,14-15H,6-7H2,1-3H3.
What are the key properties of 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide?
5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide has a molecular weight of 313.39 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-N-(2,2-difluoro-3-hydroxypropyl)thiophene-2-sulfonamide is sourced from PubChem (CID 136531965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).