C10H14IN3O4S — CID 136533230
3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-5-iodo-1-methylpyrimidine-2,4-dione (PubChem CID 136533230) has the molecular formula C10H14IN3O4S and a molecular weight of 399.21 g/mol. Its IUPAC name is 3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-5-iodo-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-5-iodo-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136533230 |
| Molecular Formula | C10H14IN3O4S |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | 3-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-5-iodo-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(I)c(=O)n(CCN2CCCS2(=O)=O)c1=O |
| InChI | InChI=1S/C10H14IN3O4S/c1-12-7-8(11)9(15)14(10(12)16)5-4-13-3-2-6-19(13,17)18/h7H,2-6H2,1H3 |
| InChIKey | OQYTVHROSPHSOS-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 81.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|