About 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one
1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one (PubChem CID 136533500) has the molecular formula C16H16BrN3O2
and a molecular weight of 362.23 g/mol. Its IUPAC name is 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one |
| PubChem CID | 136533500 |
| Molecular Formula | C16H16BrN3O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one |
| SMILES | Cc1cc(Br)c2c(c1)CN(C(=O)Cn1cccnc1=O)CC2 |
| InChI | InChI=1S/C16H16BrN3O2/c1-11-7-12-9-19(6-3-13(12)14(17)8-11)15(21)10-20-5-2-4-18-16(20)22/h2,4-5,7-8H,3,6,9-10H2,1H3 |
| InChIKey | DOXKQIZLYRXXDL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one?
The IUPAC name of 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one (CID 136533500) is 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one.
What is the SMILES notation for 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one?
The canonical SMILES for 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one is Cc1cc(Br)c2c(c1)CN(C(=O)Cn1cccnc1=O)CC2.
What is the InChIKey of 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one?
The InChIKey is DOXKQIZLYRXXDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrN3O2/c1-11-7-12-9-19(6-3-13(12)14(17)8-11)15(21)10-20-5-2-4-18-16(20)22/h2,4-5,7-8H,3,6,9-10H2,1H3.
What are the key properties of 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one?
1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one has a molecular weight of 362.23 g/mol, XLogP of 1.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5-bromo-7-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrimidin-2-one is sourced from PubChem (CID 136533500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).