C13H13ClF3NO2 — CID 136533613
(5-chloro-2-fluorophenyl)-[4-(difluoromethyl)-4-hydroxypiperidin-1-yl]methanone (PubChem CID 136533613) has the molecular formula C13H13ClF3NO2 and a molecular weight of 307.70 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[4-(difluoromethyl)-4-hydroxypiperidin-1-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[4-(difluoromethyl)-4-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136533613 |
| Molecular Formula | C13H13ClF3NO2 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[4-(difluoromethyl)-4-hydroxypiperidin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1F)N1CCC(O)(C(F)F)CC1 |
| InChI | InChI=1S/C13H13ClF3NO2/c14-8-1-2-10(15)9(7-8)11(19)18-5-3-13(20,4-6-18)12(16)17/h1-2,7,12,20H,3-6H2 |
| InChIKey | RQAAKXXAXKXGLH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |