About 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone
1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 136534343) has the molecular formula C14H23N5O3S2
and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone |
| PubChem CID | 136534343 |
| Molecular Formula | C14H23N5O3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | CN1CCN(S(=O)(=O)N2CCN(C(=O)Cc3cncs3)CC2)CC1 |
| InChI | InChI=1S/C14H23N5O3S2/c1-16-2-6-18(7-3-16)24(21,22)19-8-4-17(5-9-19)14(20)10-13-11-15-12-23-13/h11-12H,2-10H2,1H3 |
| InChIKey | WBVRMIPILRQPJS-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 77.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone (CID 136534343) is 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone is CN1CCN(S(=O)(=O)N2CCN(C(=O)Cc3cncs3)CC2)CC1.
What is the InChIKey of 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone?
The InChIKey is WBVRMIPILRQPJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O3S2/c1-16-2-6-18(7-3-16)24(21,22)19-8-4-17(5-9-19)14(20)10-13-11-15-12-23-13/h11-12H,2-10H2,1H3.
What are the key properties of 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone?
1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone has a molecular weight of 373.50 g/mol, XLogP of -0.68, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]-2-(1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 136534343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).