C13H13IN4O — CID 136535082
2-iodo-N-[1-(1H-1,2,4-triazol-5-yl)cyclobutyl]benzamide (PubChem CID 136535082) has the molecular formula C13H13IN4O and a molecular weight of 368.18 g/mol. Its IUPAC name is 2-iodo-N-[1-(1H-1,2,4-triazol-5-yl)cyclobutyl]benzamide.
| Compound Name | 2-iodo-N-[1-(1H-1,2,4-triazol-5-yl)cyclobutyl]benzamide |
|---|---|
| PubChem CID | 136535082 |
| Molecular Formula | C13H13IN4O |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 2-iodo-N-[1-(1H-1,2,4-triazol-5-yl)cyclobutyl]benzamide |
| SMILES | O=C(NC1(c2ncn[nH]2)CCC1)c1ccccc1I |
| InChI | InChI=1S/C13H13IN4O/c14-10-5-2-1-4-9(10)11(19)17-13(6-3-7-13)12-15-8-16-18-12/h1-2,4-5,8H,3,6-7H2,(H,17,19)(H,15,16,18) |
| InChIKey | GLYRQOHEIBQAJL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|