C20H31N3O3 — CID 136535287
4-[acetyl(methyl)amino]-N-[(2-methyl-4-propoxyphenyl)methyl]piperidine-1-carboxamide (PubChem CID 136535287) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-[acetyl(methyl)amino]-N-[(2-methyl-4-propoxyphenyl)methyl]piperidine-1-carboxamide.
| Compound Name | 4-[acetyl(methyl)amino]-N-[(2-methyl-4-propoxyphenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 136535287 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 4-[acetyl(methyl)amino]-N-[(2-methyl-4-propoxyphenyl)methyl]piperidine-1-carboxamide |
| SMILES | CCCOc1ccc(CNC(=O)N2CCC(N(C)C(C)=O)CC2)c(C)c1 |
| InChI | InChI=1S/C20H31N3O3/c1-5-12-26-19-7-6-17(15(2)13-19)14-21-20(25)23-10-8-18(9-11-23)22(4)16(3)24/h6-7,13,18H,5,8-12,14H2,1-4H3,(H,21,25) |
| InChIKey | GUQBLBBMBUBLPC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |