C17H29N3O2 — CID 136536606
3,3-dimethyl-1-(5-morpholin-4-ylpentanoyl)piperidine-2-carbonitrile (PubChem CID 136536606) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 3,3-dimethyl-1-(5-morpholin-4-ylpentanoyl)piperidine-2-carbonitrile.
| Compound Name | 3,3-dimethyl-1-(5-morpholin-4-ylpentanoyl)piperidine-2-carbonitrile |
|---|---|
| PubChem CID | 136536606 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 3,3-dimethyl-1-(5-morpholin-4-ylpentanoyl)piperidine-2-carbonitrile |
| SMILES | CC1(C)CCCN(C(=O)CCCCN2CCOCC2)C1C#N |
| InChI | InChI=1S/C17H29N3O2/c1-17(2)7-5-9-20(15(17)14-18)16(21)6-3-4-8-19-10-12-22-13-11-19/h15H,3-13H2,1-2H3 |
| InChIKey | LYWWDGRZENXKTC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|