C13H15F3N6O — CID 136536698
5-cyclopropyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1,3,4-oxadiazol-2-amine (PubChem CID 136536698) has the molecular formula C13H15F3N6O and a molecular weight of 328.30 g/mol. Its IUPAC name is 5-cyclopropyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-cyclopropyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 136536698 |
| Molecular Formula | C13H15F3N6O |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 5-cyclopropyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1,3,4-oxadiazol-2-amine |
| SMILES | FC(F)(F)C1CCc2nnc(CNc3nnc(C4CC4)o3)n2C1 |
| InChI | InChI=1S/C13H15F3N6O/c14-13(15,16)8-3-4-9-18-19-10(22(9)6-8)5-17-12-21-20-11(23-12)7-1-2-7/h7-8H,1-6H2,(H,17,21) |
| InChIKey | MUHSUMLXSJLGFZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |