C19H27N3O3 — CID 136536818
1-(3-methylpiperidin-1-yl)-2-[4-[(4-methyl-2-pyridinyl)oxy]piperidin-1-yl]ethane-1,2-dione (PubChem CID 136536818) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 1-(3-methylpiperidin-1-yl)-2-[4-[(4-methyl-2-pyridinyl)oxy]piperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(3-methylpiperidin-1-yl)-2-[4-[(4-methyl-2-pyridinyl)oxy]piperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 136536818 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-(3-methylpiperidin-1-yl)-2-[4-[(4-methyl-2-pyridinyl)oxy]piperidin-1-yl]ethane-1,2-dione |
| SMILES | Cc1ccnc(OC2CCN(C(=O)C(=O)N3CCCC(C)C3)CC2)c1 |
| InChI | InChI=1S/C19H27N3O3/c1-14-5-8-20-17(12-14)25-16-6-10-21(11-7-16)18(23)19(24)22-9-3-4-15(2)13-22/h5,8,12,15-16H,3-4,6-7,9-11,13H2,1-2H3 |
| InChIKey | XAWYRWMRFMAUTQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|