About 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine
2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine (PubChem CID 136537304) has the molecular formula C18H25FN4O
and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine.
Molecular Properties
| Compound Name | 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine |
| PubChem CID | 136537304 |
| Molecular Formula | C18H25FN4O |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine |
| SMILES | CCn1nc(C)c(CN2CCC(Oc3ncccc3F)CC2)c1C |
| InChI | InChI=1S/C18H25FN4O/c1-4-23-14(3)16(13(2)21-23)12-22-10-7-15(8-11-22)24-18-17(19)6-5-9-20-18/h5-6,9,15H,4,7-8,10-12H2,1-3H3 |
| InChIKey | MVOWPDZJILFNKB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine?
The IUPAC name of 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine (CID 136537304) is 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine.
What is the SMILES notation for 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine?
The canonical SMILES for 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine is CCn1nc(C)c(CN2CCC(Oc3ncccc3F)CC2)c1C.
What is the InChIKey of 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine?
The InChIKey is MVOWPDZJILFNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25FN4O/c1-4-23-14(3)16(13(2)21-23)12-22-10-7-15(8-11-22)24-18-17(19)6-5-9-20-18/h5-6,9,15H,4,7-8,10-12H2,1-3H3.
What are the key properties of 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine?
2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine has a molecular weight of 332.42 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]piperidin-4-yl]oxy-3-fluoropyridine is sourced from PubChem (CID 136537304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).