C16H20ClN3O3 — CID 136538299
4-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]morpholin-3-one (PubChem CID 136538299) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 4-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]morpholin-3-one.
| Compound Name | 4-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]morpholin-3-one |
|---|---|
| PubChem CID | 136538299 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-[2-[4-(3-chlorophenyl)piperazin-1-yl]-2-oxoethyl]morpholin-3-one |
| SMILES | O=C(CN1CCOCC1=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H20ClN3O3/c17-13-2-1-3-14(10-13)18-4-6-19(7-5-18)15(21)11-20-8-9-23-12-16(20)22/h1-3,10H,4-9,11-12H2 |
| InChIKey | HWMJQVSMNXCCMF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |