C17H14N4O3S — CID 136539318
5-(1H-indazol-6-ylmethyl)-3-(4-methylsulfonylphenyl)-1,2,4-oxadiazole (PubChem CID 136539318) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is 5-(1H-indazol-6-ylmethyl)-3-(4-methylsulfonylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(1H-indazol-6-ylmethyl)-3-(4-methylsulfonylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 136539318 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 5-(1H-indazol-6-ylmethyl)-3-(4-methylsulfonylphenyl)-1,2,4-oxadiazole |
| SMILES | CS(=O)(=O)c1ccc(-c2noc(Cc3ccc4cn[nH]c4c3)n2)cc1 |
| InChI | InChI=1S/C17H14N4O3S/c1-25(22,23)14-6-4-12(5-7-14)17-19-16(24-21-17)9-11-2-3-13-10-18-20-15(13)8-11/h2-8,10H,9H2,1H3,(H,18,20) |
| InChIKey | XTZRLEGULXZYJA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |