About N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide
N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 136539371) has the molecular formula C9H15F3N2O3S
and a molecular weight of 288.29 g/mol. Its IUPAC name is N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| PubChem CID | 136539371 |
| Molecular Formula | C9H15F3N2O3S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | CCS(=O)(=O)NC(=O)C1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O3S/c1-2-18(16,17)13-8(15)7-3-4-14(5-7)6-9(10,11)12/h7H,2-6H2,1H3,(H,13,15) |
| InChIKey | MZOXAQZBYTVWBG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide?
The IUPAC name of N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (CID 136539371) is N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
What is the SMILES notation for N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide?
The canonical SMILES for N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide is CCS(=O)(=O)NC(=O)C1CCN(CC(F)(F)F)C1.
What is the InChIKey of N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide?
The InChIKey is MZOXAQZBYTVWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3S/c1-2-18(16,17)13-8(15)7-3-4-14(5-7)6-9(10,11)12/h7H,2-6H2,1H3,(H,13,15).
What are the key properties of N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide?
N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide has a molecular weight of 288.29 g/mol, XLogP of 0.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylsulfonyl-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide is sourced from PubChem (CID 136539371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).