C15H18N4O — CID 136539503
2-ethyl-N-[1-(1H-1,2,4-triazol-5-yl)cyclobutyl]benzamide (PubChem CID 136539503) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-ethyl-N-[1-(1H-1,2,4-triazol-5-yl)cyclobutyl]benzamide.
| Compound Name | 2-ethyl-N-[1-(1H-1,2,4-triazol-5-yl)cyclobutyl]benzamide |
|---|---|
| PubChem CID | 136539503 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-ethyl-N-[1-(1H-1,2,4-triazol-5-yl)cyclobutyl]benzamide |
| SMILES | CCc1ccccc1C(=O)NC1(c2ncn[nH]2)CCC1 |
| InChI | InChI=1S/C15H18N4O/c1-2-11-6-3-4-7-12(11)13(20)18-15(8-5-9-15)14-16-10-17-19-14/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,18,20)(H,16,17,19) |
| InChIKey | BUDNXCBWHQKVLB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |