C12H12F3N5O — CID 136539852
1-ethyl-N-(4-methylpyrimidin-2-yl)-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 136539852) has the molecular formula C12H12F3N5O and a molecular weight of 299.26 g/mol. Its IUPAC name is 1-ethyl-N-(4-methylpyrimidin-2-yl)-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-(4-methylpyrimidin-2-yl)-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 136539852 |
| Molecular Formula | C12H12F3N5O |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-ethyl-N-(4-methylpyrimidin-2-yl)-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)Nc2nccc(C)n2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H12F3N5O/c1-3-20-6-8(9(19-20)12(13,14)15)10(21)18-11-16-5-4-7(2)17-11/h4-6H,3H2,1-2H3,(H,16,17,18,21) |
| InChIKey | BJJOHWCICBCOEP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |