About 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine
7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine (PubChem CID 136540118) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine.
Molecular Properties
| Compound Name | 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine |
| PubChem CID | 136540118 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine |
| SMILES | Cc1ccc2c(c1)N(CCN1CCOCC1C)CCCO2 |
| InChI | InChI=1S/C17H26N2O2/c1-14-4-5-17-16(12-14)19(6-3-10-21-17)8-7-18-9-11-20-13-15(18)2/h4-5,12,15H,3,6-11,13H2,1-2H3 |
| InChIKey | RMHZBUQUDUJMFJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine?
The IUPAC name of 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine (CID 136540118) is 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine.
What is the SMILES notation for 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine?
The canonical SMILES for 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine is Cc1ccc2c(c1)N(CCN1CCOCC1C)CCCO2.
What is the InChIKey of 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine?
The InChIKey is RMHZBUQUDUJMFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-14-4-5-17-16(12-14)19(6-3-10-21-17)8-7-18-9-11-20-13-15(18)2/h4-5,12,15H,3,6-11,13H2,1-2H3.
What are the key properties of 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine?
7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine has a molecular weight of 290.41 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5-[2-(3-methylmorpholin-4-yl)ethyl]-3,4-dihydro-2H-1,5-benzoxazepine is sourced from PubChem (CID 136540118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).