About 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane
7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane (PubChem CID 136540584) has the molecular formula C14H17F2NO
and a molecular weight of 253.29 g/mol. Its IUPAC name is 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane |
| PubChem CID | 136540584 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane |
| SMILES | Fc1ccc(CN2CCC3(CCO3)CC2)cc1F |
| InChI | InChI=1S/C14H17F2NO/c15-12-2-1-11(9-13(12)16)10-17-6-3-14(4-7-17)5-8-18-14/h1-2,9H,3-8,10H2 |
| InChIKey | FOGLRHKHWXOTSR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane?
The IUPAC name of 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane (CID 136540584) is 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane.
What is the SMILES notation for 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane?
The canonical SMILES for 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane is Fc1ccc(CN2CCC3(CCO3)CC2)cc1F.
What is the InChIKey of 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane?
The InChIKey is FOGLRHKHWXOTSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO/c15-12-2-1-11(9-13(12)16)10-17-6-3-14(4-7-17)5-8-18-14/h1-2,9H,3-8,10H2.
What are the key properties of 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane?
7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane has a molecular weight of 253.29 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3,4-difluorophenyl)methyl]-1-oxa-7-azaspiro[3.5]nonane is sourced from PubChem (CID 136540584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).