C17H17N3O2 — CID 136541713
2-(cyclopropanecarbonylamino)-N-methyl-N-phenylpyridine-4-carboxamide (PubChem CID 136541713) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(cyclopropanecarbonylamino)-N-methyl-N-phenylpyridine-4-carboxamide.
| Compound Name | 2-(cyclopropanecarbonylamino)-N-methyl-N-phenylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 136541713 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-(cyclopropanecarbonylamino)-N-methyl-N-phenylpyridine-4-carboxamide |
| SMILES | CN(C(=O)c1ccnc(NC(=O)C2CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O2/c1-20(14-5-3-2-4-6-14)17(22)13-9-10-18-15(11-13)19-16(21)12-7-8-12/h2-6,9-12H,7-8H2,1H3,(H,18,19,21) |
| InChIKey | IEVRYKFRNJACGD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |