C14H21N5O — CID 136542360
2,2,6,6-tetramethyl-4-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)morpholine (PubChem CID 136542360) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)morpholine.
| Compound Name | 2,2,6,6-tetramethyl-4-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)morpholine |
|---|---|
| PubChem CID | 136542360 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)morpholine |
| SMILES | Cc1nc2ccc(N3CC(C)(C)OC(C)(C)C3)nn2n1 |
| InChI | InChI=1S/C14H21N5O/c1-10-15-11-6-7-12(17-19(11)16-10)18-8-13(2,3)20-14(4,5)9-18/h6-7H,8-9H2,1-5H3 |
| InChIKey | FKYFVJBQJXPAIW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |