C13H18N6O — CID 136543923
(1-tert-butyl-1,2,4-triazol-3-yl)-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)methanone (PubChem CID 136543923) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is (1-tert-butyl-1,2,4-triazol-3-yl)-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)methanone.
| Compound Name | (1-tert-butyl-1,2,4-triazol-3-yl)-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 136543923 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (1-tert-butyl-1,2,4-triazol-3-yl)-(1,4,6,7-tetrahydropyrazolo[4,5-c]pyridin-5-yl)methanone |
| SMILES | CC(C)(C)n1cnc(C(=O)N2CCc3[nH]ncc3C2)n1 |
| InChI | InChI=1S/C13H18N6O/c1-13(2,3)19-8-14-11(17-19)12(20)18-5-4-10-9(7-18)6-15-16-10/h6,8H,4-5,7H2,1-3H3,(H,15,16) |
| InChIKey | BONUWNFVWDNWSH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |