C14H21N5O — CID 136543974
5-[4-ethyl-3-(1H-imidazol-2-yl)piperazin-1-yl]-5-oxopentanenitrile (PubChem CID 136543974) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 5-[4-ethyl-3-(1H-imidazol-2-yl)piperazin-1-yl]-5-oxopentanenitrile.
| Compound Name | 5-[4-ethyl-3-(1H-imidazol-2-yl)piperazin-1-yl]-5-oxopentanenitrile |
|---|---|
| PubChem CID | 136543974 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 5-[4-ethyl-3-(1H-imidazol-2-yl)piperazin-1-yl]-5-oxopentanenitrile |
| SMILES | CCN1CCN(C(=O)CCCC#N)CC1c1ncc[nH]1 |
| InChI | InChI=1S/C14H21N5O/c1-2-18-9-10-19(13(20)5-3-4-6-15)11-12(18)14-16-7-8-17-14/h7-8,12H,2-5,9-11H2,1H3,(H,16,17) |
| InChIKey | AXVVUEMNPDCJOX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|