C13H15NO4 — CID 136544172
3-(5-methylfuran-2-yl)-N-(3-methyl-2-oxooxolan-3-yl)prop-2-enamide (PubChem CID 136544172) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-(5-methylfuran-2-yl)-N-(3-methyl-2-oxooxolan-3-yl)prop-2-enamide.
| Compound Name | 3-(5-methylfuran-2-yl)-N-(3-methyl-2-oxooxolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 136544172 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-(5-methylfuran-2-yl)-N-(3-methyl-2-oxooxolan-3-yl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NC2(C)CCOC2=O)o1 |
| InChI | InChI=1S/C13H15NO4/c1-9-3-4-10(18-9)5-6-11(15)14-13(2)7-8-17-12(13)16/h3-6H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | BKXNQOZZSAXDSQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|