About N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide
N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide (PubChem CID 136544175) has the molecular formula C15H17IN2O
and a molecular weight of 368.22 g/mol. Its IUPAC name is N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide |
| PubChem CID | 136544175 |
| Molecular Formula | C15H17IN2O |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide |
| SMILES | Cc1cc(I)cc(C(=O)NC2(C#N)CC2(C)C)c1C |
| InChI | InChI=1S/C15H17IN2O/c1-9-5-11(16)6-12(10(9)2)13(19)18-15(8-17)7-14(15,3)4/h5-6H,7H2,1-4H3,(H,18,19) |
| InChIKey | SBUFBRNJCYDNEZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide?
The IUPAC name of N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide (CID 136544175) is N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide.
What is the SMILES notation for N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide?
The canonical SMILES for N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide is Cc1cc(I)cc(C(=O)NC2(C#N)CC2(C)C)c1C.
What is the InChIKey of N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide?
The InChIKey is SBUFBRNJCYDNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17IN2O/c1-9-5-11(16)6-12(10(9)2)13(19)18-15(8-17)7-14(15,3)4/h5-6H,7H2,1-4H3,(H,18,19).
What are the key properties of N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide?
N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide has a molecular weight of 368.22 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyano-2,2-dimethylcyclopropyl)-5-iodo-2,3-dimethylbenzamide is sourced from PubChem (CID 136544175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).