C18H29NO4S — CID 136544926
N-[(3-ethoxy-4-methoxyphenyl)methyl]-4-(methylsulfonylmethyl)cyclohexan-1-amine (PubChem CID 136544926) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is N-[(3-ethoxy-4-methoxyphenyl)methyl]-4-(methylsulfonylmethyl)cyclohexan-1-amine.
| Compound Name | N-[(3-ethoxy-4-methoxyphenyl)methyl]-4-(methylsulfonylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 136544926 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[(3-ethoxy-4-methoxyphenyl)methyl]-4-(methylsulfonylmethyl)cyclohexan-1-amine |
| SMILES | CCOc1cc(CNC2CCC(CS(C)(=O)=O)CC2)ccc1OC |
| InChI | InChI=1S/C18H29NO4S/c1-4-23-18-11-15(7-10-17(18)22-2)12-19-16-8-5-14(6-9-16)13-24(3,20)21/h7,10-11,14,16,19H,4-6,8-9,12-13H2,1-3H3 |
| InChIKey | QRKSDUWYVCLVOA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |