C13H15F4N5 — CID 136545792
5-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-3-(difluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 136545792) has the molecular formula C13H15F4N5 and a molecular weight of 317.29 g/mol. Its IUPAC name is 5-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-3-(difluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 5-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-3-(difluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 136545792 |
| Molecular Formula | C13H15F4N5 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 5-[[1-(2,2-difluoroethyl)pyrazol-4-yl]methyl]-3-(difluoromethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | FC(F)Cn1cc(CN2CCc3[nH]nc(C(F)F)c3C2)cn1 |
| InChI | InChI=1S/C13H15F4N5/c14-11(15)7-22-5-8(3-18-22)4-21-2-1-10-9(6-21)12(13(16)17)20-19-10/h3,5,11,13H,1-2,4,6-7H2,(H,19,20) |
| InChIKey | GXJXBLXFBUPXRR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |